C17H19F3N4O2S — CID 55364171
N-[(E)-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-(trifluoromethyl)aniline (PubChem CID 55364171) has the molecular formula C17H19F3N4O2S and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[(E)-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-(trifluoromethyl)aniline.
| Compound Name | N-[(E)-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 55364171 |
| Molecular Formula | C17H19F3N4O2S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[(E)-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]methylideneamino]-2-(trifluoromethyl)aniline |
| SMILES | Cc1nn(C2CCS(=O)(=O)C2)c(C)c1/C=N/Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H19F3N4O2S/c1-11-14(12(2)24(23-11)13-7-8-27(25,26)10-13)9-21-22-16-6-4-3-5-15(16)17(18,19)20/h3-6,9,13,22H,7-8,10H2,1-2H3/b21-9+ |
| InChIKey | SNRPAPNWQLUFFY-ZVBGSRNCSA-N |
| XLogP | 3.32 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|