C18H18ClFN2O4S — CID 7830582
(2-fluorophenyl)methyl (E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 7830582) has the molecular formula C18H18ClFN2O4S and a molecular weight of 412.87 g/mol. Its IUPAC name is (2-fluorophenyl)methyl (E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | (2-fluorophenyl)methyl (E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7830582 |
| Molecular Formula | C18H18ClFN2O4S |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (2-fluorophenyl)methyl (E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(Cl)c1/C=C/C(=O)OCc1ccccc1F |
| InChI | InChI=1S/C18H18ClFN2O4S/c1-12-15(18(19)22(21-12)14-8-9-27(24,25)11-14)6-7-17(23)26-10-13-4-2-3-5-16(13)20/h2-7,14H,8-11H2,1H3/b7-6+/t14-/m0/s1 |
| InChIKey | CQRCSMKBBRHWST-UZYOAWRESA-N |
| XLogP | 3.10 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|