C23H22ClN3O5S — CID 6267712
[2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 6267712) has the molecular formula C23H22ClN3O5S and a molecular weight of 487.97 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 6267712 |
| Molecular Formula | C23H22ClN3O5S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(C2CCS(=O)(=O)C2)c(Cl)c1/C=C/C(=O)OCC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C23H22ClN3O5S/c1-15-18(23(24)27(26-15)17-11-12-33(30,31)14-17)9-10-22(29)32-13-21(28)25-20-8-4-6-16-5-2-3-7-19(16)20/h2-10,17H,11-14H2,1H3,(H,25,28)/b10-9+ |
| InChIKey | DTYSLNBLRNFPPB-MDZDMXLPSA-N |
| XLogP | 3.55 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|