C19H18Cl2N4O7S — CID 25346923
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 25346923) has the molecular formula C19H18Cl2N4O7S and a molecular weight of 517.35 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 25346923 |
| Molecular Formula | C19H18Cl2N4O7S |
| Molecular Weight | 517.35 g/mol |
| Exact Mass | 516.03 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(Cl)c1/C=C/C(=O)OCC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18Cl2N4O7S/c1-11-14(19(21)24(23-11)13-6-7-33(30,31)10-13)3-5-18(27)32-9-17(26)22-15-4-2-12(20)8-16(15)25(28)29/h2-5,8,13H,6-7,9-10H2,1H3,(H,22,26)/b5-3+/t13-/m0/s1 |
| InChIKey | KTEQVNADKPVGKL-LQPUYASZSA-N |
| XLogP | 2.96 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|