C20H18Cl2N4O5S — CID 4832646
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 4832646) has the molecular formula C20H18Cl2N4O5S and a molecular weight of 497.36 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4832646 |
| Molecular Formula | C20H18Cl2N4O5S |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(C2CCS(=O)(=O)C2)c(Cl)c1C=CC(=O)OCC(=O)Nc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C20H18Cl2N4O5S/c1-12-16(20(22)26(25-12)15-6-7-32(29,30)11-15)4-5-19(28)31-10-18(27)24-17-8-14(21)3-2-13(17)9-23/h2-5,8,15H,6-7,10-11H2,1H3,(H,24,27) |
| InChIKey | SOCXANUEIPODQH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 131.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|