C20H21ClN4O8S — CID 2484289
[2-(2-methoxy-5-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 2484289) has the molecular formula C20H21ClN4O8S and a molecular weight of 512.93 g/mol. Its IUPAC name is [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2484289 |
| Molecular Formula | C20H21ClN4O8S |
| Molecular Weight | 512.93 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)/C=C/c1c(C)nn([C@@H]2CCS(=O)(=O)C2)c1Cl |
| InChI | InChI=1S/C20H21ClN4O8S/c1-12-15(20(21)24(23-12)14-7-8-34(30,31)11-14)4-6-19(27)33-10-18(26)22-16-9-13(25(28)29)3-5-17(16)32-2/h3-6,9,14H,7-8,10-11H2,1-2H3,(H,22,26)/b6-4+/t14-/m1/s1 |
| InChIKey | GCSUBIXLBQPYLR-YVARQFDVSA-N |
| XLogP | 2.32 |
| TPSA | 159.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.93 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|