C17H19ClN4O5S — CID 4831645
(4-amino-3-cyano-2-oxopent-3-enyl) 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 4831645) has the molecular formula C17H19ClN4O5S and a molecular weight of 426.88 g/mol. Its IUPAC name is (4-amino-3-cyano-2-oxopent-3-enyl) 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | (4-amino-3-cyano-2-oxopent-3-enyl) 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4831645 |
| Molecular Formula | C17H19ClN4O5S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | (4-amino-3-cyano-2-oxopent-3-enyl) 3-[5-chloro-1-(1,1-dioxothiolan-3-yl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | CC(N)=C(C#N)C(=O)COC(=O)C=Cc1c(C)nn(C2CCS(=O)(=O)C2)c1Cl |
| InChI | InChI=1S/C17H19ClN4O5S/c1-10(20)14(7-19)15(23)8-27-16(24)4-3-13-11(2)21-22(17(13)18)12-5-6-28(25,26)9-12/h3-4,12H,5-6,8-9,20H2,1-2H3 |
| InChIKey | NVJPHDKACRSSIZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 145.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|