C18H17ClN2O3S — CID 8857032
(2E)-2-[[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylidene]-3H-inden-1-one (PubChem CID 8857032) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is (2E)-2-[[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylidene]-3H-inden-1-one.
| Compound Name | (2E)-2-[[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 8857032 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (2E)-2-[[5-chloro-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]methylidene]-3H-inden-1-one |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(Cl)c1/C=C1\Cc2ccccc2C1=O |
| InChI | InChI=1S/C18H17ClN2O3S/c1-11-16(9-13-8-12-4-2-3-5-15(12)17(13)22)18(19)21(20-11)14-6-7-25(23,24)10-14/h2-5,9,14H,6-8,10H2,1H3/b13-9+/t14-/m1/s1 |
| InChIKey | HESZGWYDOHTIRC-KADHNRKRSA-N |
| XLogP | 3.03 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|