C15H21N5O4S — CID 9352742
N-cyclopropyl-N'-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]oxamide (PubChem CID 9352742) has the molecular formula C15H21N5O4S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 9352742 |
| Molecular Formula | C15H21N5O4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-cyclopropyl-N'-[(Z)-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]oxamide |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1/C=N\NC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C15H21N5O4S/c1-9-13(7-16-18-15(22)14(21)17-11-3-4-11)10(2)20(19-9)12-5-6-25(23,24)8-12/h7,11-12H,3-6,8H2,1-2H3,(H,17,21)(H,18,22)/b16-7-/t12-/m1/s1 |
| InChIKey | NAZBOGCRGBHAQL-YNUIFBACSA-N |
| XLogP | -0.41 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|