C16H27N5O2S2 — CID 9155115
1-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-pentylthiourea (PubChem CID 9155115) has the molecular formula C16H27N5O2S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is 1-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-pentylthiourea.
| Compound Name | 1-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9155115 |
| Molecular Formula | C16H27N5O2S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)N/N=C\c1c(C)nn([C@H]2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C16H27N5O2S2/c1-4-5-6-8-17-16(24)19-18-10-15-12(2)20-21(13(15)3)14-7-9-25(22,23)11-14/h10,14H,4-9,11H2,1-3H3,(H2,17,19,24)/b18-10-/t14-/m0/s1 |
| InChIKey | RHISRSKFMNWKLC-KPYNCUPYSA-N |
| XLogP | 1.85 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|