C20H23N5O3S — CID 9147420
(3E)-3-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidenehydrazinylidene]-1-ethylindol-2-one (PubChem CID 9147420) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is (3E)-3-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidenehydrazinylidene]-1-ethylindol-2-one.
| Compound Name | (3E)-3-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidenehydrazinylidene]-1-ethylindol-2-one |
|---|---|
| PubChem CID | 9147420 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (3E)-3-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidenehydrazinylidene]-1-ethylindol-2-one |
| SMILES | CCN1C(=O)/C(=N/N=C\c2c(C)nn([C@H]3CCS(=O)(=O)C3)c2C)c2ccccc21 |
| InChI | InChI=1S/C20H23N5O3S/c1-4-24-18-8-6-5-7-16(18)19(20(24)26)22-21-11-17-13(2)23-25(14(17)3)15-9-10-29(27,28)12-15/h5-8,11,15H,4,9-10,12H2,1-3H3/b21-11-,22-19+/t15-/m0/s1 |
| InChIKey | XMJSHSPRHJFZEK-PUJWRKRCSA-N |
| XLogP | 2.05 |
| TPSA | 96.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|