C19H25N5O2S2 — CID 9148003
3-benzyl-1-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-1-methylthiourea (PubChem CID 9148003) has the molecular formula C19H25N5O2S2 and a molecular weight of 419.58 g/mol. Its IUPAC name is 3-benzyl-1-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-1-methylthiourea.
| Compound Name | 3-benzyl-1-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-1-methylthiourea |
|---|---|
| PubChem CID | 9148003 |
| Molecular Formula | C19H25N5O2S2 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-benzyl-1-[(Z)-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-1-methylthiourea |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1/C=N\N(C)C(=S)NCc1ccccc1 |
| InChI | InChI=1S/C19H25N5O2S2/c1-14-18(15(2)24(22-14)17-9-10-28(25,26)13-17)12-21-23(3)19(27)20-11-16-7-5-4-6-8-16/h4-8,12,17H,9-11,13H2,1-3H3,(H,20,27)/b21-12-/t17-/m0/s1 |
| InChIKey | ZVEGMAAUXDLTEH-WCEBZYJUSA-N |
| XLogP | 2.20 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|