C23H26N4O2S — CID 24893362
N-benzyl-N-[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]aniline (PubChem CID 24893362) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-benzyl-N-[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]aniline.
| Compound Name | N-benzyl-N-[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 24893362 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-benzyl-N-[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylideneamino]aniline |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1C=NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N4O2S/c1-18-23(19(2)27(25-18)22-13-14-30(28,29)17-22)15-24-26(21-11-7-4-8-12-21)16-20-9-5-3-6-10-20/h3-12,15,22H,13-14,16-17H2,1-2H3/t22-/m1/s1 |
| InChIKey | ROCXYSISBZKKFL-JOCHJYFZSA-N |
| XLogP | 3.90 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|