C17H11FN2O3S — CID 135711795
4-[[(5Z)-5-[(4-fluorophenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoic acid (PubChem CID 135711795) has the molecular formula C17H11FN2O3S and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-[[(5Z)-5-[(4-fluorophenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoic acid.
| Compound Name | 4-[[(5Z)-5-[(4-fluorophenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 135711795 |
| Molecular Formula | C17H11FN2O3S |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4-[[(5Z)-5-[(4-fluorophenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoic acid |
| SMILES | O=C1NC(=N\c2ccc(C(=O)O)cc2)/C(=C/c2ccc(F)cc2)S1 |
| InChI | InChI=1S/C17H11FN2O3S/c18-12-5-1-10(2-6-12)9-14-15(20-17(23)24-14)19-13-7-3-11(4-8-13)16(21)22/h1-9H,(H,21,22)(H,19,20,23)/b14-9- |
| InChIKey | SEVBPCXENYZWRG-ZROIWOOFSA-N |
| XLogP | 4.05 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|