C21H20N2O5S — CID 135711684
ethyl 4-[[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoate (PubChem CID 135711684) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is ethyl 4-[[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135711684 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | ethyl 4-[[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-1,3-thiazolidin-4-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\NC(=O)S\C2=C/c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-4-28-20(24)14-6-8-15(9-7-14)22-19-18(29-21(25)23-19)12-13-5-10-16(26-2)17(11-13)27-3/h5-12H,4H2,1-3H3,(H,22,23,25)/b18-12- |
| InChIKey | ROGAMHXVCMBLLP-PDGQHHTCSA-N |
| XLogP | 4.41 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|