C23H15N3O3S — CID 135782343
(5Z)-4-(4-hydroxyphenyl)imino-5-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]-1,3-thiazolidin-2-one (PubChem CID 135782343) has the molecular formula C23H15N3O3S and a molecular weight of 413.46 g/mol. Its IUPAC name is (5Z)-4-(4-hydroxyphenyl)imino-5-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-4-(4-hydroxyphenyl)imino-5-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135782343 |
| Molecular Formula | C23H15N3O3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (5Z)-4-(4-hydroxyphenyl)imino-5-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=N\c2ccc(O)cc2)/C(=C/c2ccc3noc(-c4ccccc4)c3c2)S1 |
| InChI | InChI=1S/C23H15N3O3S/c27-17-9-7-16(8-10-17)24-22-20(30-23(28)25-22)13-14-6-11-19-18(12-14)21(29-26-19)15-4-2-1-3-5-15/h1-13,27H,(H,24,25,28)/b20-13- |
| InChIKey | DXQWTWFXFVPQDD-MOSHPQCFSA-N |
| XLogP | 5.73 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|