C17H10N2O2S2 — CID 4709580
5-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 4709580) has the molecular formula C17H10N2O2S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 5-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | 5-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 4709580 |
| Molecular Formula | C17H10N2O2S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 5-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=S)C(=Cc2ccc3noc(-c4ccccc4)c3c2)S1 |
| InChI | InChI=1S/C17H10N2O2S2/c20-17-18-16(22)14(23-17)9-10-6-7-13-12(8-10)15(21-19-13)11-4-2-1-3-5-11/h1-9H,(H,18,20,22) |
| InChIKey | KVLOAZMYTRVCAO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|