C24H17N3O2 — CID 4709583
5-methyl-2-phenyl-4-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]pyrazol-3-one (PubChem CID 4709583) has the molecular formula C24H17N3O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]pyrazol-3-one.
| Compound Name | 5-methyl-2-phenyl-4-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 4709583 |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 5-methyl-2-phenyl-4-[(3-phenyl-2,1-benzoxazol-5-yl)methylidene]pyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=Cc1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H17N3O2/c1-16-20(24(28)27(25-16)19-10-6-3-7-11-19)14-17-12-13-22-21(15-17)23(29-26-22)18-8-4-2-5-9-18/h2-15H,1H3 |
| InChIKey | QYSWWQXBUSQGCX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|