C19H13NO — CID 15446367
3,5-diphenyl-2,1-benzoxazole (PubChem CID 15446367) has the molecular formula C19H13NO and a molecular weight of 271.32 g/mol. Its IUPAC name is 3,5-diphenyl-2,1-benzoxazole.
| Compound Name | 3,5-diphenyl-2,1-benzoxazole |
|---|---|
| PubChem CID | 15446367 |
| Molecular Formula | C19H13NO |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3,5-diphenyl-2,1-benzoxazole |
| SMILES | c1ccc(-c2ccc3noc(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C19H13NO/c1-3-7-14(8-4-1)16-11-12-18-17(13-16)19(21-20-18)15-9-5-2-6-10-15/h1-13H |
| InChIKey | OBVGIUFUQVYNEJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |