About 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole
5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole (PubChem CID 18874757) has the molecular formula C17H15NO2S
and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole.
Molecular Properties
| Compound Name | 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole |
| PubChem CID | 18874757 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole |
| SMILES | CC1(c2ccc3noc(-c4ccccc4)c3c2)OCCS1 |
| InChI | InChI=1S/C17H15NO2S/c1-17(19-9-10-21-17)13-7-8-15-14(11-13)16(20-18-15)12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3 |
| InChIKey | HBOFVMRHGGEQLU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole?
The IUPAC name of 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole (CID 18874757) is 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole.
What is the SMILES notation for 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole?
The canonical SMILES for 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole is CC1(c2ccc3noc(-c4ccccc4)c3c2)OCCS1.
What is the InChIKey of 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole?
The InChIKey is HBOFVMRHGGEQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2S/c1-17(19-9-10-21-17)13-7-8-15-14(11-13)16(20-18-15)12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3.
What are the key properties of 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole?
5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole has a molecular weight of 297.38 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,3-oxathiolan-2-yl)-3-phenyl-2,1-benzoxazole is sourced from PubChem (CID 18874757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).