About 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol
3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol (PubChem CID 137218432) has the molecular formula C22H14N2O2
and a molecular weight of 338.37 g/mol. Its IUPAC name is 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol.
Molecular Properties
| Compound Name | 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol |
| PubChem CID | 137218432 |
| Molecular Formula | C22H14N2O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol |
| SMILES | Oc1ccc2cc(-c3ccc4noc(-c5ccccc5)c4c3)cnc2c1 |
| InChI | InChI=1S/C22H14N2O2/c25-18-8-6-16-10-17(13-23-21(16)12-18)15-7-9-20-19(11-15)22(26-24-20)14-4-2-1-3-5-14/h1-13,25H |
| InChIKey | LPDQFRIESJBLBM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol?
The IUPAC name of 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol (CID 137218432) is 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol.
What is the SMILES notation for 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol?
The canonical SMILES for 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol is Oc1ccc2cc(-c3ccc4noc(-c5ccccc5)c4c3)cnc2c1.
What is the InChIKey of 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol?
The InChIKey is LPDQFRIESJBLBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N2O2/c25-18-8-6-16-10-17(13-23-21(16)12-18)15-7-9-20-19(11-15)22(26-24-20)14-4-2-1-3-5-14/h1-13,25H.
What are the key properties of 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol?
3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol has a molecular weight of 338.37 g/mol, XLogP of 5.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-phenyl-2,1-benzoxazol-5-yl)quinolin-7-ol is sourced from PubChem (CID 137218432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).