C11H11NOS — CID 548236
4-(2-methyl-1,3-oxathiolan-2-yl)benzonitrile (PubChem CID 548236) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 4-(2-methyl-1,3-oxathiolan-2-yl)benzonitrile.
| Compound Name | 4-(2-methyl-1,3-oxathiolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 548236 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-(2-methyl-1,3-oxathiolan-2-yl)benzonitrile |
| SMILES | CC1(c2ccc(C#N)cc2)OCCS1 |
| InChI | InChI=1S/C11H11NOS/c1-11(13-6-7-14-11)10-4-2-9(8-12)3-5-10/h2-5H,6-7H2,1H3 |
| InChIKey | OSECVBSLXIRGRK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |