About 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile
4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile (PubChem CID 162782443) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile.
Molecular Properties
| Compound Name | 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile |
| PubChem CID | 162782443 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile |
| SMILES | N#Cc1ccc(C23CCC4(CC2C3)OCCO4)cc1 |
| InChI | InChI=1S/C16H17NO2/c17-11-12-1-3-13(4-2-12)15-5-6-16(10-14(15)9-15)18-7-8-19-16/h1-4,14H,5-10H2 |
| InChIKey | ABRMENDIVSKSJP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile?
The IUPAC name of 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile (CID 162782443) is 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile.
What is the SMILES notation for 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile?
The canonical SMILES for 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile is N#Cc1ccc(C23CCC4(CC2C3)OCCO4)cc1.
What is the InChIKey of 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile?
The InChIKey is ABRMENDIVSKSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c17-11-12-1-3-13(4-2-12)15-5-6-16(10-14(15)9-15)18-7-8-19-16/h1-4,14H,5-10H2.
What are the key properties of 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile?
4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile has a molecular weight of 255.32 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylbenzonitrile is sourced from PubChem (CID 162782443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).