C28H33ClO6S — CID 139551163
(3R,4R,5S,6R)-2-[4-chloro-3-[(4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylphenyl)methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 139551163) has the molecular formula C28H33ClO6S and a molecular weight of 533.09 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[4-chloro-3-[(4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylphenyl)methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-[4-chloro-3-[(4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylphenyl)methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 139551163 |
| Molecular Formula | C28H33ClO6S |
| Molecular Weight | 533.09 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | (3R,4R,5S,6R)-2-[4-chloro-3-[(4-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylphenyl)methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CS[C@H]1OC(c2ccc(Cl)c(Cc3ccc(C45CCC6(CC4C5)OCCO6)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H33ClO6S/c1-36-26-24(32)22(30)23(31)25(35-26)17-4-7-21(29)18(13-17)12-16-2-5-19(6-3-16)27-8-9-28(15-20(27)14-27)33-10-11-34-28/h2-7,13,20,22-26,30-32H,8-12,14-15H2,1H3/t20?,22-,23-,24+,25?,26-,27?/m1/s1 |
| InChIKey | BHJFIJSOESTSMX-FXSUUTOBSA-N |
| XLogP | 3.96 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.09 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |