C26H32ClNO8S — CID 133081772
2-[4-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanoylamino]propanoic acid (PubChem CID 133081772) has the molecular formula C26H32ClNO8S and a molecular weight of 554.06 g/mol. Its IUPAC name is 2-[4-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanoylamino]propanoic acid.
| Compound Name | 2-[4-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 133081772 |
| Molecular Formula | C26H32ClNO8S |
| Molecular Weight | 554.06 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 2-[4-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanoylamino]propanoic acid |
| SMILES | CS[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OCCCC(=O)NC(C)C(=O)O)cc3)c2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H32ClNO8S/c1-14(25(33)34)28-20(29)4-3-11-35-18-8-5-15(6-9-18)12-17-13-16(7-10-19(17)27)24-22(31)21(30)23(32)26(36-24)37-2/h5-10,13-14,21-24,26,30-32H,3-4,11-12H2,1-2H3,(H,28,29)(H,33,34)/t14?,21-,22?,23+,24+,26-/m1/s1 |
| InChIKey | VUYFWWIQZZDGJY-YTDDFWNUSA-N |
| XLogP | 2.52 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.06 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|