C27H38N2O6S — CID 133081846
2,2-dimethyl-3-[2-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]ethylamino]propanamide (PubChem CID 133081846) has the molecular formula C27H38N2O6S and a molecular weight of 518.68 g/mol. Its IUPAC name is 2,2-dimethyl-3-[2-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]ethylamino]propanamide.
| Compound Name | 2,2-dimethyl-3-[2-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]ethylamino]propanamide |
|---|---|
| PubChem CID | 133081846 |
| Molecular Formula | C27H38N2O6S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 2,2-dimethyl-3-[2-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]ethylamino]propanamide |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(OCCNCC(C)(C)C(N)=O)cc3)c2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H38N2O6S/c1-16-5-8-18(24-22(31)21(30)23(32)25(35-24)36-4)14-19(16)13-17-6-9-20(10-7-17)34-12-11-29-15-27(2,3)26(28)33/h5-10,14,21-25,29-32H,11-13,15H2,1-4H3,(H2,28,33)/t21-,22?,23+,24+,25-/m1/s1 |
| InChIKey | BJBAQGABRJPLAO-HIASLCRASA-N |
| XLogP | 1.91 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|