C34H49N3O6S — CID 133081866
2,2-dimethyl-3-[4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]butanoylamino]-N-piperidin-4-ylpropanamide (PubChem CID 133081866) has the molecular formula C34H49N3O6S and a molecular weight of 627.85 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]butanoylamino]-N-piperidin-4-ylpropanamide.
| Compound Name | 2,2-dimethyl-3-[4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]butanoylamino]-N-piperidin-4-ylpropanamide |
|---|---|
| PubChem CID | 133081866 |
| Molecular Formula | C34H49N3O6S |
| Molecular Weight | 627.85 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | 2,2-dimethyl-3-[4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]butanoylamino]-N-piperidin-4-ylpropanamide |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(CCCC(=O)NCC(C)(C)C(=O)NC4CCNCC4)cc3)c2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C34H49N3O6S/c1-21-8-13-24(31-29(40)28(39)30(41)32(43-31)44-4)19-25(21)18-23-11-9-22(10-12-23)6-5-7-27(38)36-20-34(2,3)33(42)37-26-14-16-35-17-15-26/h8-13,19,26,28-32,35,39-41H,5-7,14-18,20H2,1-4H3,(H,36,38)(H,37,42)/t28-,29?,30+,31+,32-/m1/s1 |
| InChIKey | XXJQFCIPOCHUPU-AHNRXQODSA-N |
| XLogP | 2.76 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |