C32H45N3O6S — CID 170392454
N-[2-[2-[cyclopropyl(methyl)amino]ethylamino]-2-oxoethyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]butanamide (PubChem CID 170392454) has the molecular formula C32H45N3O6S and a molecular weight of 599.79 g/mol. Its IUPAC name is N-[2-[2-[cyclopropyl(methyl)amino]ethylamino]-2-oxoethyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]butanamide.
| Compound Name | N-[2-[2-[cyclopropyl(methyl)amino]ethylamino]-2-oxoethyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 170392454 |
| Molecular Formula | C32H45N3O6S |
| Molecular Weight | 599.79 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | N-[2-[2-[cyclopropyl(methyl)amino]ethylamino]-2-oxoethyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]butanamide |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(CCCC(=O)NCC(=O)NCCN(C)C4CC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H45N3O6S/c1-20-7-12-23(31-29(39)28(38)30(40)32(41-31)42-3)18-24(20)17-22-10-8-21(9-11-22)5-4-6-26(36)34-19-27(37)33-15-16-35(2)25-13-14-25/h7-12,18,25,28-32,38-40H,4-6,13-17,19H2,1-3H3,(H,33,37)(H,34,36)/t28-,29-,30+,31+,32-/m1/s1 |
| InChIKey | SPXQCALPAARKHZ-DSSMMGBBSA-N |
| XLogP | 2.08 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |