C31H40N2O6S — CID 166850424
N-[2-[methyl(prop-2-ynyl)amino]ethyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-[(methyl-λ4-sulfanylidyne)methyl]oxan-2-yl]phenyl]methyl]phenoxy]butanamide (PubChem CID 166850424) has the molecular formula C31H40N2O6S and a molecular weight of 568.74 g/mol. Its IUPAC name is N-[2-[methyl(prop-2-ynyl)amino]ethyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-[(methyl-λ4-sulfanylidyne)methyl]oxan-2-yl]phenyl]methyl]phenoxy]butanamide.
| Compound Name | N-[2-[methyl(prop-2-ynyl)amino]ethyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-[(methyl-λ4-sulfanylidyne)methyl]oxan-2-yl]phenyl]methyl]phenoxy]butanamide |
|---|---|
| PubChem CID | 166850424 |
| Molecular Formula | C31H40N2O6S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | N-[2-[methyl(prop-2-ynyl)amino]ethyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-[(methyl-λ4-sulfanylidyne)methyl]oxan-2-yl]phenyl]methyl]phenoxy]butanamide |
| SMILES | C#CCN(C)CCNC(=O)CCCOc1ccc(Cc2cc([C@@H]3OC(C#SC)[C@@H](O)[C@H](O)[C@H]3O)ccc2C)cc1 |
| InChI | InChI=1S/C31H40N2O6S/c1-5-15-33(3)16-14-32-27(34)7-6-17-38-25-12-9-22(10-13-25)18-24-19-23(11-8-21(24)2)31-30(37)29(36)28(35)26(39-31)20-40-4/h1,8-13,19,26,28-31,35-37H,6-7,14-18H2,2-4H3,(H,32,34)/t26?,28-,29+,30-,31+/m1/s1 |
| InChIKey | MOTZQTLZISMEAT-BBIPMLEGSA-N |
| XLogP | 2.27 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|