C25H32ClNO6S — CID 133081796
4-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]-N-ethylbutanamide (PubChem CID 133081796) has the molecular formula C25H32ClNO6S and a molecular weight of 510.05 g/mol. Its IUPAC name is 4-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]-N-ethylbutanamide.
| Compound Name | 4-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]-N-ethylbutanamide |
|---|---|
| PubChem CID | 133081796 |
| Molecular Formula | C25H32ClNO6S |
| Molecular Weight | 510.05 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 4-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]-N-ethylbutanamide |
| SMILES | CCNC(=O)CCCOc1ccc(Cc2cc([C@@H]3O[C@H](SC)[C@@H](O)[C@H](O)C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H32ClNO6S/c1-3-27-20(28)5-4-12-32-18-9-6-15(7-10-18)13-17-14-16(8-11-19(17)26)24-22(30)21(29)23(31)25(33-24)34-2/h6-11,14,21-25,29-31H,3-5,12-13H2,1-2H3,(H,27,28)/t21-,22?,23+,24+,25-/m1/s1 |
| InChIKey | SVJVJSJBSWXMCO-HIASLCRASA-N |
| XLogP | 3.07 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.05 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|