C32H44N2O8S — CID 133081857
N-(2-methyl-1-morpholin-4-yl-1-oxopropan-2-yl)-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanamide (PubChem CID 133081857) has the molecular formula C32H44N2O8S and a molecular weight of 616.78 g/mol. Its IUPAC name is N-(2-methyl-1-morpholin-4-yl-1-oxopropan-2-yl)-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanamide.
| Compound Name | N-(2-methyl-1-morpholin-4-yl-1-oxopropan-2-yl)-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanamide |
|---|---|
| PubChem CID | 133081857 |
| Molecular Formula | C32H44N2O8S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | N-(2-methyl-1-morpholin-4-yl-1-oxopropan-2-yl)-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanamide |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(OCCCC(=O)NC(C)(C)C(=O)N4CCOCC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H44N2O8S/c1-20-7-10-22(29-27(37)26(36)28(38)30(42-29)43-4)19-23(20)18-21-8-11-24(12-9-21)41-15-5-6-25(35)33-32(2,3)31(39)34-13-16-40-17-14-34/h7-12,19,26-30,36-38H,5-6,13-18H2,1-4H3,(H,33,35)/t26-,27-,28+,29+,30-/m1/s1 |
| InChIKey | IUJHWWBSRSCSTP-IXYVTWBDSA-N |
| XLogP | 2.34 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|