C34H49N3O7S — CID 133081859
N-[2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxopropyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanamide (PubChem CID 133081859) has the molecular formula C34H49N3O7S and a molecular weight of 643.85 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxopropyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanamide.
| Compound Name | N-[2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxopropyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanamide |
|---|---|
| PubChem CID | 133081859 |
| Molecular Formula | C34H49N3O7S |
| Molecular Weight | 643.85 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | N-[2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxopropyl]-4-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]butanamide |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(OCCCC(=O)NCC(C)(C)C(=O)N4CCN(C)CC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C34H49N3O7S/c1-22-8-11-24(31-29(40)28(39)30(41)32(44-31)45-5)20-25(22)19-23-9-12-26(13-10-23)43-18-6-7-27(38)35-21-34(2,3)33(42)37-16-14-36(4)15-17-37/h8-13,20,28-32,39-41H,6-7,14-19,21H2,1-5H3,(H,35,38)/t28-,29-,30+,31+,32-/m1/s1 |
| InChIKey | PMGVTGCVWXJTMN-DSSMMGBBSA-N |
| XLogP | 2.50 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.85 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|