C31H40N2O5S — CID 169294152
(E)-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-5-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]pent-4-enamide (PubChem CID 169294152) has the molecular formula C31H40N2O5S and a molecular weight of 552.74 g/mol. Its IUPAC name is (E)-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-5-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]pent-4-enamide.
| Compound Name | (E)-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-5-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]pent-4-enamide |
|---|---|
| PubChem CID | 169294152 |
| Molecular Formula | C31H40N2O5S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | (E)-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-5-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]pent-4-enamide |
| SMILES | C#CCN(C)CCNC(=O)CC/C=C/c1ccc(Cc2cc([C@@H]3O[C@H](SC)[C@@H](O)[C@H](O)C3O)ccc2C)cc1 |
| InChI | InChI=1S/C31H40N2O5S/c1-5-17-33(3)18-16-32-26(34)9-7-6-8-22-11-13-23(14-12-22)19-25-20-24(15-10-21(25)2)30-28(36)27(35)29(37)31(38-30)39-4/h1,6,8,10-15,20,27-31,35-37H,7,9,16-19H2,2-4H3,(H,32,34)/b8-6+/t27-,28?,29+,30+,31-/m1/s1 |
| InChIKey | DLBWNNZHZHOELX-VVKARJNGSA-N |
| XLogP | 2.90 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|