C30H44N2O6S — CID 133081788
1-(1-hydroxy-2-methylpropan-2-yl)-3-[5-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]pentyl]urea (PubChem CID 133081788) has the molecular formula C30H44N2O6S and a molecular weight of 560.76 g/mol. Its IUPAC name is 1-(1-hydroxy-2-methylpropan-2-yl)-3-[5-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]pentyl]urea.
| Compound Name | 1-(1-hydroxy-2-methylpropan-2-yl)-3-[5-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]pentyl]urea |
|---|---|
| PubChem CID | 133081788 |
| Molecular Formula | C30H44N2O6S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 1-(1-hydroxy-2-methylpropan-2-yl)-3-[5-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]pentyl]urea |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(CCCCCNC(=O)NC(C)(C)CO)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H44N2O6S/c1-19-9-14-22(27-25(35)24(34)26(36)28(38-27)39-4)17-23(19)16-21-12-10-20(11-13-21)8-6-5-7-15-31-29(37)32-30(2,3)18-33/h9-14,17,24-28,33-36H,5-8,15-16,18H2,1-4H3,(H2,31,32,37)/t24-,25-,26+,27+,28-/m1/s1 |
| InChIKey | RKRHIBRUKJZPQF-URYJJRPLSA-N |
| XLogP | 3.21 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|