C32H42N2O5S — CID 166850355
(E)-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-6-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]hex-5-enamide (PubChem CID 166850355) has the molecular formula C32H42N2O5S and a molecular weight of 566.76 g/mol. Its IUPAC name is (E)-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-6-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]hex-5-enamide.
| Compound Name | (E)-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-6-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]hex-5-enamide |
|---|---|
| PubChem CID | 166850355 |
| Molecular Formula | C32H42N2O5S |
| Molecular Weight | 566.76 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | (E)-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-6-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]hex-5-enamide |
| SMILES | C#CCN(C)CCNC(=O)CCC/C=C/c1ccc(Cc2cc([C@@H]3O[C@H](SC)[C@@H](O)[C@H](O)[C@H]3O)ccc2C)cc1 |
| InChI | InChI=1S/C32H42N2O5S/c1-5-18-34(3)19-17-33-27(35)10-8-6-7-9-23-12-14-24(15-13-23)20-26-21-25(16-11-22(26)2)31-29(37)28(36)30(38)32(39-31)40-4/h1,7,9,11-16,21,28-32,36-38H,6,8,10,17-20H2,2-4H3,(H,33,35)/b9-7+/t28-,29-,30+,31+,32-/m1/s1 |
| InChIKey | HVOGOBSWCCLHRN-PAJIXZHZSA-N |
| XLogP | 3.29 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|