C26H32O4S — CID 155130160
(3R,4R,5S,6R)-2-[3-[[4-(cyclohexen-1-yl)phenyl]methyl]-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 155130160) has the molecular formula C26H32O4S and a molecular weight of 440.61 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[3-[[4-(cyclohexen-1-yl)phenyl]methyl]-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-[3-[[4-(cyclohexen-1-yl)phenyl]methyl]-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 155130160 |
| Molecular Formula | C26H32O4S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (3R,4R,5S,6R)-2-[3-[[4-(cyclohexen-1-yl)phenyl]methyl]-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CS[C@H]1OC(c2ccc(C)c(Cc3ccc(C4=CCCCC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H32O4S/c1-16-8-11-20(25-23(28)22(27)24(29)26(30-25)31-2)15-21(16)14-17-9-12-19(13-10-17)18-6-4-3-5-7-18/h6,8-13,15,22-29H,3-5,7,14H2,1-2H3/t22-,23-,24+,25?,26-/m1/s1 |
| InChIKey | DDJHSBVHBYPDRL-SHYRQKFKSA-N |
| XLogP | 4.39 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |