C27H34F2O4S — CID 155483846
(2S,3R,4R,5S,6R)-2-[3-[[4-(4,4-difluorocyclohexyl)phenyl]methyl]-4-ethylphenyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 155483846) has the molecular formula C27H34F2O4S and a molecular weight of 492.63 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[[4-(4,4-difluorocyclohexyl)phenyl]methyl]-4-ethylphenyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[[4-(4,4-difluorocyclohexyl)phenyl]methyl]-4-ethylphenyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 155483846 |
| Molecular Formula | C27H34F2O4S |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[[4-(4,4-difluorocyclohexyl)phenyl]methyl]-4-ethylphenyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CCc1ccc([C@@H]2O[C@H](SC)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(C2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C27H34F2O4S/c1-3-17-8-9-20(25-23(31)22(30)24(32)26(33-25)34-2)15-21(17)14-16-4-6-18(7-5-16)19-10-12-27(28,29)13-11-19/h4-9,15,19,22-26,30-32H,3,10-14H2,1-2H3/t22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | YNXHXXLNTBCQQD-PUHDZGQXSA-N |
| XLogP | 4.98 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |