C25H32O4S2 — CID 139551081
(2S,3R,4R,5S,6R)-2-[3-[[5-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]thiophen-2-yl]methyl]-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 139551081) has the molecular formula C25H32O4S2 and a molecular weight of 460.66 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[[5-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]thiophen-2-yl]methyl]-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[[5-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]thiophen-2-yl]methyl]-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 139551081 |
| Molecular Formula | C25H32O4S2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[[5-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]thiophen-2-yl]methyl]-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc([C@]45CCCC[C@H]4C5)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H32O4S2/c1-14-6-7-15(23-21(27)20(26)22(28)24(29-23)30-2)11-16(14)12-18-8-9-19(31-18)25-10-4-3-5-17(25)13-25/h6-9,11,17,20-24,26-28H,3-5,10,12-13H2,1-2H3/t17-,20+,21+,22-,23-,24+,25-/m0/s1 |
| InChIKey | KLNWATXRIJWQER-LPAZDLLXSA-N |
| XLogP | 4.32 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |