C26H31ClO6S2 — CID 139551442
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-spiro[1,3-dioxolane-2,4'-bicyclo[3.1.1]heptane]-1'-ylthiophen-2-yl)methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 139551442) has the molecular formula C26H31ClO6S2 and a molecular weight of 539.12 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-spiro[1,3-dioxolane-2,4'-bicyclo[3.1.1]heptane]-1'-ylthiophen-2-yl)methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-spiro[1,3-dioxolane-2,4'-bicyclo[3.1.1]heptane]-1'-ylthiophen-2-yl)methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 139551442 |
| Molecular Formula | C26H31ClO6S2 |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-spiro[1,3-dioxolane-2,4'-bicyclo[3.1.1]heptane]-1'-ylthiophen-2-yl)methyl]phenyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CS[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(C45CCC6(OCCO6)C(C4)C5)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H31ClO6S2/c1-34-24-22(30)20(28)21(29)23(33-24)14-2-4-18(27)15(10-14)11-17-3-5-19(35-17)25-6-7-26(16(12-25)13-25)31-8-9-32-26/h2-5,10,16,20-24,28-30H,6-9,11-13H2,1H3/t16?,20-,21-,22+,23+,24-,25?/m1/s1 |
| InChIKey | JRUBTDKFLIFNSU-ZXMHWUPLSA-N |
| XLogP | 4.02 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |