C28H37NO6S — CID 133081852
N-[2-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]ethyl]cyclopentanecarboxamide (PubChem CID 133081852) has the molecular formula C28H37NO6S and a molecular weight of 515.67 g/mol. Its IUPAC name is N-[2-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 133081852 |
| Molecular Formula | C28H37NO6S |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | N-[2-[4-[[2-methyl-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenoxy]ethyl]cyclopentanecarboxamide |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(OCCNC(=O)C4CCCC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H37NO6S/c1-17-7-10-20(26-24(31)23(30)25(32)28(35-26)36-2)16-21(17)15-18-8-11-22(12-9-18)34-14-13-29-27(33)19-5-3-4-6-19/h7-12,16,19,23-26,28,30-32H,3-6,13-15H2,1-2H3,(H,29,33)/t23-,24-,25+,26+,28-/m1/s1 |
| InChIKey | DSQWAIODVUBIPK-DNAQHQBMSA-N |
| XLogP | 3.11 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|