C28H34O7S — CID 169296425
[(2S,3S,4R,5S,6R)-3,5-diacetyloxy-2-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-methylsulfanyloxan-4-yl] acetate (PubChem CID 169296425) has the molecular formula C28H34O7S and a molecular weight of 514.64 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-3,5-diacetyloxy-2-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-methylsulfanyloxan-4-yl] acetate.
| Compound Name | [(2S,3S,4R,5S,6R)-3,5-diacetyloxy-2-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-methylsulfanyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 169296425 |
| Molecular Formula | C28H34O7S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-3,5-diacetyloxy-2-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-methylsulfanyloxan-4-yl] acetate |
| SMILES | CCc1ccc(Cc2cc([C@@H]3O[C@H](SC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2C)cc1 |
| InChI | InChI=1S/C28H34O7S/c1-7-20-9-11-21(12-10-20)14-23-15-22(13-8-16(23)2)24-25(32-17(3)29)26(33-18(4)30)27(34-19(5)31)28(35-24)36-6/h8-13,15,24-28H,7,14H2,1-6H3/t24-,25-,26+,27-,28+/m0/s1 |
| InChIKey | BNUXWWZPCBEPKQ-AJIIGFCHSA-N |
| XLogP | 4.70 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|