C33H42O8S — CID 90183230
[(2S,3S,4R,5S,6R)-3,5-diacetyloxy-2-[3-[[4-[(E)-5-hydroxy-3,4-dimethylpent-1-enyl]phenyl]methyl]-4-methylphenyl]-6-methylsulfanyloxan-4-yl] acetate (PubChem CID 90183230) has the molecular formula C33H42O8S and a molecular weight of 598.76 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-3,5-diacetyloxy-2-[3-[[4-[(E)-5-hydroxy-3,4-dimethylpent-1-enyl]phenyl]methyl]-4-methylphenyl]-6-methylsulfanyloxan-4-yl] acetate.
| Compound Name | [(2S,3S,4R,5S,6R)-3,5-diacetyloxy-2-[3-[[4-[(E)-5-hydroxy-3,4-dimethylpent-1-enyl]phenyl]methyl]-4-methylphenyl]-6-methylsulfanyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 90183230 |
| Molecular Formula | C33H42O8S |
| Molecular Weight | 598.76 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-3,5-diacetyloxy-2-[3-[[4-[(E)-5-hydroxy-3,4-dimethylpent-1-enyl]phenyl]methyl]-4-methylphenyl]-6-methylsulfanyloxan-4-yl] acetate |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(/C=C/C(C)C(C)CO)cc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H42O8S/c1-19(21(3)18-34)8-10-25-11-13-26(14-12-25)16-28-17-27(15-9-20(28)2)29-30(38-22(4)35)31(39-23(5)36)32(40-24(6)37)33(41-29)42-7/h8-15,17,19,21,29-34H,16,18H2,1-7H3/b10-8+/t19?,21?,29-,30-,31+,32-,33+/m0/s1 |
| InChIKey | QGAGVVNMXMHDAO-PWEBNZQWSA-N |
| XLogP | 5.42 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.76 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|