C32H40O10S — CID 166846001
ethyl 3-[[4-[[2-methyl-5-[(3S,4R,5S,6R)-3,4,5-triacetyloxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]methoxy]propanoate (PubChem CID 166846001) has the molecular formula C32H40O10S and a molecular weight of 616.73 g/mol. Its IUPAC name is ethyl 3-[[4-[[2-methyl-5-[(3S,4R,5S,6R)-3,4,5-triacetyloxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]methoxy]propanoate.
| Compound Name | ethyl 3-[[4-[[2-methyl-5-[(3S,4R,5S,6R)-3,4,5-triacetyloxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]methoxy]propanoate |
|---|---|
| PubChem CID | 166846001 |
| Molecular Formula | C32H40O10S |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | ethyl 3-[[4-[[2-methyl-5-[(3S,4R,5S,6R)-3,4,5-triacetyloxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]phenyl]methoxy]propanoate |
| SMILES | CCOC(=O)CCOCc1ccc(Cc2cc(C3O[C@H](SC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2C)cc1 |
| InChI | InChI=1S/C32H40O10S/c1-7-38-27(36)14-15-37-18-24-11-9-23(10-12-24)16-26-17-25(13-8-19(26)2)28-29(39-20(3)33)30(40-21(4)34)31(41-22(5)35)32(42-28)43-6/h8-13,17,28-32H,7,14-16,18H2,1-6H3/t28?,29-,30+,31-,32+/m0/s1 |
| InChIKey | DGCFWQLGWKFYJY-WJKMWANGSA-N |
| XLogP | 4.61 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|