C29H33IN2O4 — CID 170296481
[(2S,3R)-2-[4-ethynyl-3-[[4-[3-[2-[methyl(prop-2-ynyl)amino]ethylamino]-3-oxopropoxy]phenyl]methyl]phenyl]oxan-3-yl] hypoiodite (PubChem CID 170296481) has the molecular formula C29H33IN2O4 and a molecular weight of 600.50 g/mol. Its IUPAC name is [(2S,3R)-2-[4-ethynyl-3-[[4-[3-[2-[methyl(prop-2-ynyl)amino]ethylamino]-3-oxopropoxy]phenyl]methyl]phenyl]oxan-3-yl] hypoiodite.
| Compound Name | [(2S,3R)-2-[4-ethynyl-3-[[4-[3-[2-[methyl(prop-2-ynyl)amino]ethylamino]-3-oxopropoxy]phenyl]methyl]phenyl]oxan-3-yl] hypoiodite |
|---|---|
| PubChem CID | 170296481 |
| Molecular Formula | C29H33IN2O4 |
| Molecular Weight | 600.50 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | [(2S,3R)-2-[4-ethynyl-3-[[4-[3-[2-[methyl(prop-2-ynyl)amino]ethylamino]-3-oxopropoxy]phenyl]methyl]phenyl]oxan-3-yl] hypoiodite |
| SMILES | C#CCN(C)CCNC(=O)CCOc1ccc(Cc2cc([C@@H]3OCCC[C@H]3OI)ccc2C#C)cc1 |
| InChI | InChI=1S/C29H33IN2O4/c1-4-16-32(3)17-15-31-28(33)14-19-34-26-12-8-22(9-13-26)20-25-21-24(11-10-23(25)5-2)29-27(36-30)7-6-18-35-29/h1-2,8-13,21,27,29H,6-7,14-20H2,3H3,(H,31,33)/t27-,29+/m1/s1 |
| InChIKey | ZGZIGRLSUDGZQU-PXJZQJOASA-N |
| XLogP | 4.30 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|