C24H28O6 — CID 163931297
(2S,3R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-ethynylphenyl]-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol (PubChem CID 163931297) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-ethynylphenyl]-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol.
| Compound Name | (2S,3R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-ethynylphenyl]-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 163931297 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2S,3R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-ethynylphenyl]-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol |
| SMILES | C#Cc1ccc([C@@H]2O[C@H](CO)[C@@H](OC)C(O)[C@H]2O)cc1Cc1ccc(OCC)cc1 |
| InChI | InChI=1S/C24H28O6/c1-4-16-8-9-17(23-21(26)22(27)24(28-3)20(14-25)30-23)13-18(16)12-15-6-10-19(11-7-15)29-5-2/h1,6-11,13,20-27H,5,12,14H2,2-3H3/t20-,21-,22?,23+,24-/m1/s1 |
| InChIKey | RIWRMWPPFSRFSZ-BHJRHKJSSA-N |
| XLogP | 1.83 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|