C15H16O2 — CID 168870604
1'-phenylspiro[1,3-dioxole-2,4'-bicyclo[4.1.0]heptane] (PubChem CID 168870604) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1'-phenylspiro[1,3-dioxole-2,4'-bicyclo[4.1.0]heptane].
| Compound Name | 1'-phenylspiro[1,3-dioxole-2,4'-bicyclo[4.1.0]heptane] |
|---|---|
| PubChem CID | 168870604 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1'-phenylspiro[1,3-dioxole-2,4'-bicyclo[4.1.0]heptane] |
| SMILES | C1=COC2(CCC3(c4ccccc4)CC3C2)O1 |
| InChI | InChI=1S/C15H16O2/c1-2-4-12(5-3-1)14-6-7-15(11-13(14)10-14)16-8-9-17-15/h1-5,8-9,13H,6-7,10-11H2 |
| InChIKey | SUJIDHIAXXWHSW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |