C12H14O2 — CID 100966337
(2S)-2-methyl-2-phenyl-3,4-dihydropyran-4-ol (PubChem CID 100966337) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2S)-2-methyl-2-phenyl-3,4-dihydropyran-4-ol.
| Compound Name | (2S)-2-methyl-2-phenyl-3,4-dihydropyran-4-ol |
|---|---|
| PubChem CID | 100966337 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2S)-2-methyl-2-phenyl-3,4-dihydropyran-4-ol |
| SMILES | C[C@@]1(c2ccccc2)CC(O)C=CO1 |
| InChI | InChI=1S/C12H14O2/c1-12(9-11(13)7-8-14-12)10-5-3-2-4-6-10/h2-8,11,13H,9H2,1H3/t11?,12-/m0/s1 |
| InChIKey | SFBNQPOKYNTIFN-KIYNQFGBSA-N |
| XLogP | 2.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |