C13H18O — CID 175816739
trans-(1R,3S)-2,2,3-trimethyl-3-phenylcyclobutan-1-ol (PubChem CID 175816739) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is trans-(1R,3S)-2,2,3-trimethyl-3-phenylcyclobutan-1-ol.
| Compound Name | trans-(1R,3S)-2,2,3-trimethyl-3-phenylcyclobutan-1-ol |
|---|---|
| PubChem CID | 175816739 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | trans-(1R,3S)-2,2,3-trimethyl-3-phenylcyclobutan-1-ol |
| SMILES | CC1(C)[C@H](O)C[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C13H18O/c1-12(2)11(14)9-13(12,3)10-7-5-4-6-8-10/h4-8,11,14H,9H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | CMGSLISNTWKDRK-YPMHNXCESA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |