C16H16O2 — CID 125481717
(1S,3S)-2-methyl-2-phenyl-1,3-dihydroindene-1,3-diol (PubChem CID 125481717) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1S,3S)-2-methyl-2-phenyl-1,3-dihydroindene-1,3-diol.
| Compound Name | (1S,3S)-2-methyl-2-phenyl-1,3-dihydroindene-1,3-diol |
|---|---|
| PubChem CID | 125481717 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (1S,3S)-2-methyl-2-phenyl-1,3-dihydroindene-1,3-diol |
| SMILES | CC1(c2ccccc2)[C@@H](O)c2ccccc2[C@@H]1O |
| InChI | InChI=1S/C16H16O2/c1-16(11-7-3-2-4-8-11)14(17)12-9-5-6-10-13(12)15(16)18/h2-10,14-15,17-18H,1H3/t14-,15-/m0/s1 |
| InChIKey | OCSXRAGSBOMMFA-GJZGRUSLSA-N |
| XLogP | 2.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |