C9H10O2S — CID 56950484
(2S,3R)-2-methyl-3H-1-benzothiophene-2,3-diol (PubChem CID 56950484) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is (2S,3R)-2-methyl-3H-1-benzothiophene-2,3-diol.
| Compound Name | (2S,3R)-2-methyl-3H-1-benzothiophene-2,3-diol |
|---|---|
| PubChem CID | 56950484 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | (2S,3R)-2-methyl-3H-1-benzothiophene-2,3-diol |
| SMILES | C[C@]1(O)Sc2ccccc2[C@H]1O |
| InChI | InChI=1S/C9H10O2S/c1-9(11)8(10)6-4-2-3-5-7(6)12-9/h2-5,8,10-11H,1H3/t8-,9+/m1/s1 |
| InChIKey | DTWUGVVTKIITHJ-BDAKNGLRSA-N |
| XLogP | 1.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |